Ethanesulfonic acid, compd. with 2-chloro-5-[4-[2-chloro-4- (4,6-diamino-2, 2-dimethyl-s-triazin-1(2H)-yl)phenyl]butyl]benzenesulfonyl fluoride (1:1) structure
|
Common Name | Ethanesulfonic acid, compd. with 2-chloro-5-[4-[2-chloro-4- (4,6-diamino-2, 2-dimethyl-s-triazin-1(2H)-yl)phenyl]butyl]benzenesulfonyl fluoride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 31368-51-1 | Molecular Weight | 610.54900 | |
| Density | N/A | Boiling Point | 632.2ºC at 760 mmHg | |
| Molecular Formula | C23H30Cl2FN5O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.1ºC | |
| Name | 2-chloro-5-[4-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]butyl]benzenesulfonyl fluoride,ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 632.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H30Cl2FN5O5S2 |
| Molecular Weight | 610.54900 |
| Flash Point | 336.1ºC |
| Exact Mass | 609.10500 |
| PSA | 185.27000 |
| LogP | 6.79500 |
| InChIKey | LOHXMZMTXDOGRC-UHFFFAOYSA-N |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(CCCCc2ccc(Cl)c(S(=O)(=O)F)c2)c(Cl)c1.CCS(=O)(=O)O |
| 2-chloro-5-[4-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenyl]butyl]benzenesulfonyl fluoride |
| ethanesulfonic acid-2-chloro-5-{4-[2-chloro-4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1(2h)-yl)phenyl]butyl}benzenesulfonyl fluoride(1:1) |