2-Propenal,3-(2-chloro-5-nitrophenyl) structure
|
Common Name | 2-Propenal,3-(2-chloro-5-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 31368-60-2 | Molecular Weight | 211.60200 | |
| Density | 1.396g/cm3 | Boiling Point | 368.2ºC at 760mmHg | |
| Molecular Formula | C9H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-3-(2-chloro-5-nitrophenyl)prop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 368.2ºC at 760mmHg |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60200 |
| Exact Mass | 211.00400 |
| PSA | 62.89000 |
| LogP | 2.98350 |
| Index of Refraction | 1.627 |
| InChIKey | YGRWDGMIJOLYCX-OWOJBTEDSA-N |
| SMILES | O=CC=Cc1cc([N+](=O)[O-])ccc1Cl |
|
~%
2-Propenal,3-(2... CAS#:31368-60-2 |
| Literature: Baker,B.R.; Vermeulen,N.M.J. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1154 - 1160 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-5-nitrozimtaldehyd |
| 2-chloro-5-nitro-cinnamaldehyde |