N-Methylamidophosphoric acid O-methyl O-(2-diethylamino-6-methyl-4-pyrimidinyl) ester
Modify Date: 2025-08-25 08:47:04
N-Methylamidophosphoric acid O-methyl O-(2-diethylamino-6-methyl-4-pyrimidinyl) ester structure
|
Common Name | N-Methylamidophosphoric acid O-methyl O-(2-diethylamino-6-methyl-4-pyrimidinyl) ester | ||
|---|---|---|---|---|
| CAS Number | 31377-69-2 | Molecular Weight | 288.28300 | |
| Density | 1.186g/cm3 | Boiling Point | 392.9ºC at 760 mmHg | |
| Molecular Formula | C11H21N4O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | pirimetaphos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 392.9ºC at 760 mmHg |
| Molecular Formula | C11H21N4O3P |
| Molecular Weight | 288.28300 |
| Flash Point | 191.4ºC |
| Exact Mass | 288.13500 |
| PSA | 86.39000 |
| LogP | 2.37480 |
| Index of Refraction | 1.524 |
| InChIKey | HEUHRGXVQSOSHP-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(C)cc(OP(=O)(NC)OC)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (Ξ)-[2-(diethylamino)-6-methylpyrimidin-4-yl methyl methylphosphoramidate] |
| (RS)-(2-diethylamino-6-methylpyrimidin-4-yl methyl methylphosphoramidate) |
| pyrimetaphos |
| methylphosphoramidic acid 2-diethylamino-6-methyl-pyrimidin-4-yl ester methyl ester |
| UNII-AHC2049OIO |
| 2-(diethylamino)-6-methyl-4-pyrimidinyl methyl methylphosphoramidate |
| Pirimetaphos |
| N,N-diethyl-4-[methoxy(methylamino)phosphoryl]oxy-6-methylpyrimidin-2-amine |