3-(5-methoxy-4-methyl-2-nitro-phenyl)-2-oxo-propanoic acid
Modify Date: 2025-11-25 13:20:42
3-(5-methoxy-4-methyl-2-nitro-phenyl)-2-oxo-propanoic acid structure
|
Common Name | 3-(5-methoxy-4-methyl-2-nitro-phenyl)-2-oxo-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3139-07-9 | Molecular Weight | 253.20800 | |
| Density | 1.386g/cm3 | Boiling Point | 444.1ºC at 760 mmHg | |
| Molecular Formula | C11H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | 3-(5-methoxy-4-methyl-2-nitrophenyl)-2-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 444.1ºC at 760 mmHg |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.20800 |
| Flash Point | 222.4ºC |
| Exact Mass | 253.05900 |
| PSA | 109.42000 |
| LogP | 1.63120 |
| Index of Refraction | 1.571 |
| InChIKey | JXQUSCDBXIFOKR-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(=O)C(=O)O)c([N+](=O)[O-])cc1C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-5-methoxy-4-methyl-phenylbrenztraubensaeure |
| 5-Methoxy-4-methyl-2-nitrophenylpyruvic acid |
| 3-(5-methoxy-4-methyl-2-nitro-phenyl)-2-oxo-propanoic acid |
| 5-Methoxy-4-methyl-2-nitrophenyl-brenztraubensaeure |
| 5-Methoxy-4-methyl-2-nitropheny-brenztraubensaeure |