Imidodicarbonic acid,2-(4-fluorophenyl)-, 1,3-bis(1-methylethyl) ester
Modify Date: 2025-08-25 08:27:57
Imidodicarbonic acid,2-(4-fluorophenyl)-, 1,3-bis(1-methylethyl) ester structure
|
Common Name | Imidodicarbonic acid,2-(4-fluorophenyl)-, 1,3-bis(1-methylethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 314-83-0 | Molecular Weight | 283.29500 | |
| Density | 1.188g/cm3 | Boiling Point | 341ºC at 760mmHg | |
| Molecular Formula | C14H18FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | propan-2-yl N-(4-fluorophenyl)-N-propan-2-yloxycarbonylcarbamate |
|---|
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 341ºC at 760mmHg |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.29500 |
| Flash Point | 160ºC |
| Exact Mass | 283.12200 |
| PSA | 55.84000 |
| LogP | 3.72210 |
| Index of Refraction | 1.514 |
| InChIKey | ZOKQAYXMNRXGML-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)N(C(=O)OC(C)C)c1ccc(F)cc1 |
|
~%
Imidodicarbonic... CAS#:314-83-0 |
| Literature: Stefanye et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3663 |
|
~%
Imidodicarbonic... CAS#:314-83-0 |
| Literature: Stefanye et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 3663 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |