4'-Butyl-4-methoxyazoxybenzene
Modify Date: 2025-09-19 00:09:23
4'-Butyl-4-methoxyazoxybenzene structure
|
Common Name | 4'-Butyl-4-methoxyazoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 31401-36-2 | Molecular Weight | 284.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-butylphenyl)imino-(4-methoxyphenyl)-oxidoazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20N2O2 |
|---|---|
| Molecular Weight | 284.35300 |
| Exact Mass | 284.15200 |
| PSA | 50.34000 |
| LogP | 5.48670 |
| InChIKey | BZRVTWXLAZABOC-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(N=[N+]([O-])c2ccc(OC)cc2)cc1 |
|
~%
4'-Butyl-4-meth... CAS#:31401-36-2 |
| Literature: Rondeau,R.E. et al. Journal of the American Chemical Society, 1972 , vol. 94, p. 1096 - 1102 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-butyl-4'-methoxy-azoxybenzene |
| p-butyl-p'-methoxy-azoxybenzene |
| 4-n-butyl-4'-methoxy-azoxybenzene |
| 4-methoxy-4'-n-butyl-azoxybenzene |
| p-n-butyl-p-methoxyazoxybenzene |