3-fluoro-N-(4-iodo-2-methylphenyl)benzamide structure
|
Common Name | 3-fluoro-N-(4-iodo-2-methylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 314022-37-2 | Molecular Weight | 355.14600 | |
| Density | 1.684g/cm3 | Boiling Point | 330.4ºC at 760 mmHg | |
| Molecular Formula | C14H11FINO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.6ºC | |
| Name | 3-fluoro-N-(4-iodo-2-methylphenyl)benzamide |
|---|
| Density | 1.684g/cm3 |
|---|---|
| Boiling Point | 330.4ºC at 760 mmHg |
| Molecular Formula | C14H11FINO |
| Molecular Weight | 355.14600 |
| Flash Point | 153.6ºC |
| Exact Mass | 354.98700 |
| PSA | 29.10000 |
| LogP | 4.06400 |
| Index of Refraction | 1.667 |
| InChIKey | XVBGNVVKCZERCV-UHFFFAOYSA-N |
| SMILES | Cc1cc(I)ccc1NC(=O)c1cccc(F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |