5-BENZYL-4-ETHYL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 5-BENZYL-4-ETHYL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 31405-22-8 | Molecular Weight | 219.30600 | |
| Density | 1.21g/cm3 | Boiling Point | 315.8ºC at 760mmHg | |
| Molecular Formula | C11H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8ºC | |
| Name | 3-benzyl-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 315.8ºC at 760mmHg |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.30600 |
| Flash Point | 144.8ºC |
| Exact Mass | 219.08300 |
| PSA | 69.51000 |
| LogP | 2.17750 |
| Index of Refraction | 1.643 |
| InChIKey | GMKFDKUHIRAVBS-UHFFFAOYSA-N |
| SMILES | CCn1c(Cc2ccccc2)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-benzyl-4-ethyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 5-benzyl-4-ethyl-4H-1,2,4-triazole-3-thiol |
| 4h-1,2,4-triazole-3-thiol,4-ethyl-5-(phenylmethyl) |
| 4-Aethyl-5-benzyl-4H-<1,2,4>triazol-3-thiol |