5-(4-chlorophenyl)-1H-pyrimidine-2-thione structure
|
Common Name | 5-(4-chlorophenyl)-1H-pyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 31408-24-9 | Molecular Weight | 222.69400 | |
| Density | 1.35g/cm3 | Boiling Point | 357.1ºC at 760 mmHg | |
| Molecular Formula | C10H7ClN2S | Melting Point | 265-268ºC | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 5-(4-chlorophenyl)-1H-pyrimidine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 357.1ºC at 760 mmHg |
| Melting Point | 265-268ºC |
| Molecular Formula | C10H7ClN2S |
| Molecular Weight | 222.69400 |
| Flash Point | 169.8ºC |
| Exact Mass | 222.00200 |
| PSA | 64.58000 |
| LogP | 3.08570 |
| Index of Refraction | 1.674 |
| InChIKey | TWTICSLSIMZTBQ-UHFFFAOYSA-N |
| SMILES | S=c1ncc(-c2ccc(Cl)cc2)c[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-chloro-phenyl)-1H-pyrimidine-2-thione |
| 5-(4-chlorophenyl)pyrimidine-2-thiol |
| 7J-591S |
| chlorophenylpyrimidinethiol |
| 5-p-Chlorphenylpyrimidin-2-thiol |
| 5-(4-chlorophenyl)-2-pyrimidinethiol |