4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid
Modify Date: 2025-10-06 19:53:11
4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid structure
|
Common Name | 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 31409-39-9 | Molecular Weight | 232.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O3 |
|---|---|
| Molecular Weight | 232.23 |
| InChIKey | GPXIICLDPSTMEE-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(=O)n(-c2ccc(C(=O)O)cc2)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid? |
| A: SMILES notation of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid is Cc1[nH]c(=O)n(-c2ccc(C(=O)O)cc2)c1C. |
| Q: What is the English name of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid? |
| A: The English name of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid is 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid. |
| Q: What is the InChIKey of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid? |
| A: InChIKey of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid is GPXIICLDPSTMEE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid? |
| A: Molecular weight of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid is 232.23. |
| Q: What is the CAS number of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid? |
| A: CAS number of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid is 31409-39-9. |
| Q: What is the molecular formula of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid? |
| A: Molecular formula of 4-(4,5-Dimethyl-2-oxo-2,3-dihydro-1H-imidazol-1-yl)benzoic acid is C12H12N2O3. |
| Q: What is the Chinese name of 31409-39-9? |
| A: Chinese name of 31409-39-9 is 31409-39-9. |