2'-C-Methyluridine structure
|
Common Name | 2'-C-Methyluridine | ||
|---|---|---|---|---|
| CAS Number | 31448-54-1 | Molecular Weight | 258.23 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O6 | Melting Point | 110-112ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-C-Methyluridine2'-C-methyluridine is a uridine analog. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
| Name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-C-methyluridine is a uridine analog. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 110-112ºC |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 |
| Exact Mass | 258.085175 |
| PSA | 124.78000 |
| LogP | -0.85 |
| Index of Refraction | 1.615 |
| InChIKey | NBKORJKMMVZAOZ-VPCXQMTMSA-N |
| SMILES | CC1(O)C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| 2'-C-Methyluridine |
| BCX-4018 |
| Uridine,2'-C-methyl |
| 2'-methyluridine |
| Uridine, 2'-C-methyl- |
| 2'-C-methyl uridine |
| 1-((2R,3R,4R,5R)-TETRAHYDRO-3,4-DIHYDROXY-5-(HYDROXYMETHYL)-3-METHYLFURAN-2-YL)PYRIMIDINE-2,4(1H,3H)-DIONE |