5,6-Acenaphthylenedicarboxamide,1,2-dihydro-N5,N5,N6,N6-tetramethyl- structure
|
Common Name | 5,6-Acenaphthylenedicarboxamide,1,2-dihydro-N5,N5,N6,N6-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 31458-06-7 | Molecular Weight | 296.36400 | |
| Density | 1.207g/cm3 | Boiling Point | 538.9ºC at 760mmHg | |
| Molecular Formula | C18H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.9ºC | |
| Name | 5-N,5-N,6-N,6-N-tetramethyl-1,2-dihydroacenaphthylene-5,6-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 538.9ºC at 760mmHg |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.36400 |
| Flash Point | 255.9ºC |
| Exact Mass | 296.15200 |
| PSA | 40.62000 |
| LogP | 2.34200 |
| Index of Refraction | 1.639 |
| InChIKey | BGVXWUHUICSRBB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc2c3c(ccc(C(=O)N(C)C)c13)CC2 |
| HS Code | 2924299090 |
|---|
|
~71%
5,6-Acenaphthyl... CAS#:31458-06-7 |
| Literature: Barattin, Regis; Gourdon, Andre European Journal of Organic Chemistry, 2009 , # 7 p. 1022 - 1026 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N,N',N'-tetramethyl-5,6-acenaphthylenedicarbamide |
| Acenaphten-5,6-dicarbonsaeure-di-N,N-dimethylamid |
| acenaphthene-4,5-dicarboxylic acid-di-N,N-dimethylamide |
| N5,N5,N6,N6-tetramethyl-1,2-dihydroacenaphthylene-5,6-dicarboxamide |
| Acenaphthen-5,6-dicarbonsaeure-bis-dimethylamid |