H-Glu-Val-Phe-OH structure
|
Common Name | H-Glu-Val-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 31461-61-7 | Molecular Weight | 393.43400 | |
| Density | 1.268g/cm3 | Boiling Point | 743ºC at 760mmHg | |
| Molecular Formula | C19H27N3O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 403.2ºC | |
Use of H-Glu-Val-Phe-OH(S)-4-Amino-5-(((S)-1-(((S)-1-carboxy-2-phenylethyl)amino)-3-methyl-1-oxobutan-2-yl)amino)-5-oxopentanoic acid is a phenylalanine derivative[1]. |
| Name | h-glu-val-phe-oh |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-4-Amino-5-(((S)-1-(((S)-1-carboxy-2-phenylethyl)amino)-3-methyl-1-oxobutan-2-yl)amino)-5-oxopentanoic acid is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 743ºC at 760mmHg |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.43400 |
| Flash Point | 403.2ºC |
| Exact Mass | 393.19000 |
| PSA | 158.82000 |
| LogP | 1.61350 |
| Index of Refraction | 1.561 |
| InChIKey | FVGOGEGGQLNZGH-DZKIICNBSA-N |
| SMILES | CC(C)C(NC(=O)C(N)CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
|
Post-translational arginylation and intracellular proteolysis.
Biomed. Biochim. Acta 50(4-6) , 343-6, (1991) Cellular proteins may be designated to fast degradation by their N-terminal amino acids, and especially a N-terminal arginine residue should have an extremely destabilizing effect on cytosol proteins.... |
| glutamyl-valyl-phenylalanine |
| GLU-VAL-PHE |
| L-Glu-L-Val-L-Phe-OH |
| Glu-Val-Phe-OH |