4-Thiazolidinone,2-thioxo-3-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | 4-Thiazolidinone,2-thioxo-3-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 315-08-2 | Molecular Weight | 277.28600 | |
| Density | 1.58g/cm3 | Boiling Point | 338.1ºC at 760mmHg | |
| Molecular Formula | C10H6F3NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | 2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760mmHg |
| Molecular Formula | C10H6F3NOS2 |
| Molecular Weight | 277.28600 |
| Flash Point | 158.3ºC |
| Exact Mass | 276.98400 |
| PSA | 77.70000 |
| LogP | 3.13510 |
| Index of Refraction | 1.633 |
| InChIKey | MRDJXDJVVCNDND-UHFFFAOYSA-N |
| SMILES | O=C1CSC(=S)N1c1cccc(C(F)(F)F)c1 |
| HS Code | 2934999090 |
|---|
|
~%
4-Thiazolidinon... CAS#:315-08-2 |
| Literature: US2011/105565 A1, ; Page/Page column 26-28 ; |
|
~52%
4-Thiazolidinon... CAS#:315-08-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 24 p. 7843 - 7854 |
|
~%
4-Thiazolidinon... CAS#:315-08-2 |
| Literature: US2011/105565 A1, ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |