3-Nitrophenyl beta-D-galactopyranoside structure
|
Common Name | 3-Nitrophenyl beta-D-galactopyranoside | ||
|---|---|---|---|---|
| CAS Number | 3150-25-2 | Molecular Weight | 301.24900 | |
| Density | 1.599 g/cm3 | Boiling Point | 573.5ºC at 760 mmHg | |
| Molecular Formula | C12H15NO8 | Melting Point | 178-179ºC | |
| MSDS | N/A | Flash Point | 300.6ºC | |
| Name | 3-Nitrophenyl b-D-galactopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.599 g/cm3 |
|---|---|
| Boiling Point | 573.5ºC at 760 mmHg |
| Melting Point | 178-179ºC |
| Molecular Formula | C12H15NO8 |
| Molecular Weight | 301.24900 |
| Flash Point | 300.6ºC |
| Exact Mass | 301.08000 |
| PSA | 145.20000 |
| Index of Refraction | 1.647 |
| InChIKey | VCCMGHVCRFMITI-YBXAARCKSA-N |
| SMILES | O=[N+]([O-])c1cccc(OC2OC(CO)C(O)C(O)C2O)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| NITROPHENYL-B-D-GALACTOPYRANOSIDE,3 |
| 3-NITROPHENYL-B-D-GALACTOSIDE |
| 3-Nitrophenylb-D-galactopyranoside |