5-Hydroxy-6,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one structure
|
Common Name | 5-Hydroxy-6,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 3151-82-4 | Molecular Weight | 328.31600 | |
| Density | 1.314g/cm3 | Boiling Point | 556.6ºC at 760mmHg | |
| Molecular Formula | C18H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | 5-hydroxy-6,7,8-trimethoxy-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 556.6ºC at 760mmHg |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.31600 |
| Flash Point | 205.3ºC |
| Exact Mass | 328.09500 |
| PSA | 78.13000 |
| LogP | 3.19140 |
| Index of Refraction | 1.606 |
| InChIKey | VOLPCZWHFBZDQT-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(O)c2c(=O)cc(-c3ccccc3)oc2c1OC |
| HS Code | 2914509090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Alnetin |
| 5-Hydroxy-6,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| 5-hydroxy-6,7,8-trimethoxy-2-phenyl-chromen-4-one |
| 5-hydroxy-6,7,8-trimethoxyflavone |