Panasenoside structure
|
Common Name | Panasenoside | ||
|---|---|---|---|---|
| CAS Number | 31512-06-8 | Molecular Weight | 610.518 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 995.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C27H30O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.3±27.8 °C | |
Use of PanasenosidePanasenoside is a flavonoid isolated from Lilium pumilum D. C. Panasenoside exhibits α-glucosidase inhibitory activity[1]. |
| Name | Panasenoside |
|---|---|
| Synonym | More Synonyms |
| Description | Panasenoside is a flavonoid isolated from Lilium pumilum D. C. Panasenoside exhibits α-glucosidase inhibitory activity[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: α-glucosidase[1] |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 995.0±65.0 °C at 760 mmHg |
| Molecular Formula | C27H30O16 |
| Molecular Weight | 610.518 |
| Flash Point | 329.3±27.8 °C |
| Exact Mass | 610.153381 |
| LogP | -0.58 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.764 |
| InChIKey | LKZDFKLGDGSGEO-PABQPRPFSA-N |
| SMILES | O=c1c(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| kaempferol 3-O-β-D-glucosylgalactoside |
| 4H-1-Benzopyran-4-one, 3-[(2-O-β-D-glucopyranosyl-β-D-galactopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)- |