5-amino-2,4-dihydro-4-methyl-2-[4-(methylsulphonyl)phenyl]-3H-pyrazol-3-one structure
|
Common Name | 5-amino-2,4-dihydro-4-methyl-2-[4-(methylsulphonyl)phenyl]-3H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 31522-06-2 | Molecular Weight | 267.30400 | |
| Density | 1.47g/cm3 | Boiling Point | 488.9ºC at 760mmHg | |
| Molecular Formula | C11H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.5ºC | |
| Name | 5-amino-4-methyl-2-(4-methylsulfonylphenyl)-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 488.9ºC at 760mmHg |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.30400 |
| Flash Point | 249.5ºC |
| Exact Mass | 267.06800 |
| PSA | 98.71000 |
| LogP | 2.12900 |
| Index of Refraction | 1.666 |
| InChIKey | GAWHRVNMHWCETC-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(c2ccc(S(C)(=O)=O)cc2)N=C1N |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 250-676-8 |