3-(m-aminophenyl)-N-(4-chloro-2,5-dimethoxyphenyl)-3-oxopropionamide structure
|
Common Name | 3-(m-aminophenyl)-N-(4-chloro-2,5-dimethoxyphenyl)-3-oxopropionamide | ||
|---|---|---|---|---|
| CAS Number | 31522-24-4 | Molecular Weight | 348.78100 | |
| Density | 1.337g/cm3 | Boiling Point | 599.1ºC at 760mmHg | |
| Molecular Formula | C17H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.1ºC | |
| Name | 3-(3-aminophenyl)-N-(4-chloro-2,5-dimethoxyphenyl)-3-oxopropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 599.1ºC at 760mmHg |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.78100 |
| Flash Point | 316.1ºC |
| Exact Mass | 348.08800 |
| PSA | 94.14000 |
| LogP | 4.38160 |
| Index of Refraction | 1.628 |
| InChIKey | ZBCHZFVYNMECCF-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)CC(=O)c2cccc(N)c2)c(OC)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 250-681-5 |
| 3-Aminobenzoylacet-2',5'-dimethoxy-4'-chloranilid |