methyl 2-methylprop-2-enoate,prop-2-enamide,styrene
Modify Date: 2025-11-28 22:42:22
methyl 2-methylprop-2-enoate,prop-2-enamide,styrene structure
|
Common Name | methyl 2-methylprop-2-enoate,prop-2-enamide,styrene | ||
|---|---|---|---|---|
| CAS Number | 31551-02-7 | Molecular Weight | 275.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-methylprop-2-enoate,prop-2-enamide,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21NO3 |
|---|---|
| Molecular Weight | 275.34300 |
| Exact Mass | 275.15200 |
| PSA | 70.38000 |
| LogP | 3.87250 |
| InChIKey | WGOHKAZPXXKHGK-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CC(N)=O.C=Cc1ccccc1 |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethenylbenzene and 2-propenamide |