3,4-dichloro-5-(dichloromethylidene)furan-2-one structure
|
Common Name | 3,4-dichloro-5-(dichloromethylidene)furan-2-one | ||
|---|---|---|---|---|
| CAS Number | 31555-54-1 | Molecular Weight | 233.86400 | |
| Density | 1.81g/cm3 | Boiling Point | 153.4ºC at 760mmHg | |
| Molecular Formula | C5Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 49.1ºC | |
| Name | 3,4-dichloro-5-(dichloromethylidene)furan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 153.4ºC at 760mmHg |
| Molecular Formula | C5Cl4O2 |
| Molecular Weight | 233.86400 |
| Flash Point | 49.1ºC |
| Exact Mass | 231.86500 |
| PSA | 26.30000 |
| LogP | 2.87910 |
| Index of Refraction | 1.586 |
| InChIKey | LJFHCOCOSGVUAD-UHFFFAOYSA-N |
| SMILES | O=C1OC(=C(Cl)Cl)C(Cl)=C1Cl |
|
~15%
3,4-dichloro-5-... CAS#:31555-54-1 |
| Literature: Smeds; Franzen; Kronberg Environmental Science and Technology, 1995 , vol. 29, # 7 p. 1839 - 1844 |
|
~%
3,4-dichloro-5-... CAS#:31555-54-1 |
| Literature: Roedig; Maerkl Justus Liebigs Annalen der Chemie, 1960 , vol. 636, p. 1,13 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-Dichloro-5-dichloromethylene-2-furanone |
| 3,4-dichloro-5-dichloromethylene-5H-furan-2-one |
| Perchlor-protoanemonin |
| Tetrachlorprotoanemonin |
| 3,4-Dichlor-5-dichlormethylen-5H-furan-2-on |