2-[4-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)phenyl]-4,4-dimethyl-1,3-oxazol-5-one structure
|
Common Name | 2-[4-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)phenyl]-4,4-dimethyl-1,3-oxazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 31578-05-9 | Molecular Weight | 300.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)phenyl]-4,4-dimethyl-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16N2O4 |
|---|---|
| Molecular Weight | 300.30900 |
| Exact Mass | 300.11100 |
| PSA | 77.32000 |
| LogP | 0.72180 |
| InChIKey | ZFEMNACSNMBKPE-UHFFFAOYSA-N |
| SMILES | CC1(C)N=C(c2ccc(C3=NC(C)(C)C(=O)O3)cc2)OC1=O |
|
~%
2-[4-(4,4-dimet... CAS#:31578-05-9 |
| Literature: Cleaver; Pratt Journal of the American Chemical Society, 1955 , vol. 77, p. 1544 |
|
~%
2-[4-(4,4-dimet... CAS#:31578-05-9 |
| Literature: Cleaver; Pratt Journal of the American Chemical Society, 1955 , vol. 77, p. 1544 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4,4',4'-tetramethyl-4H,4'H-2,2'-p-phenylene-bis-oxazol-5-one |
| 4,4,4',4'-Tetramethyl-4H,4'H-2,2'-p-phenylen-bis-oxazol-5-on |