ethyl 2,4-dihydroxy-3,6-dimethylbenzoate structure
|
Common Name | ethyl 2,4-dihydroxy-3,6-dimethylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 31581-32-5 | Molecular Weight | 210.22600 | |
| Density | 1.213g/cm3 | Boiling Point | 371.2ºC at 760 mmHg | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | ethyl 2,4-dihydroxy-3,6-dimethylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 371.2ºC at 760 mmHg |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.22600 |
| Flash Point | 144.5ºC |
| Exact Mass | 210.08900 |
| PSA | 66.76000 |
| LogP | 1.89130 |
| Index of Refraction | 1.56 |
| InChIKey | VJLLNFDLMWPNBN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)cc(O)c(C)c1O |
| HS Code | 2918199090 |
|---|
|
~%
ethyl 2,4-dihyd... CAS#:31581-32-5 |
| Literature: Schleich, Sonja; Papaioannou, Maria; Baniahmad, Aria; Matusch, Rudolf Planta Medica, 2006 , vol. 72, # 6 p. 547 - 551 |
|
~%
ethyl 2,4-dihyd... CAS#:31581-32-5 |
| Literature: Whalley Journal of the Chemical Society, 1949 , p. 3278 |
|
~%
ethyl 2,4-dihyd... CAS#:31581-32-5 |
| Literature: Fujikawa; Shimamura; Tarui Yakugaku Zasshi, 1941 , vol. 61, p. 191,194; dtsch. Ref. S. 81 Chem.Abstr., 1950 , p. 8888 |
|
~%
ethyl 2,4-dihyd... CAS#:31581-32-5 |
| Literature: Robertson; Stephenson Journal of the Chemical Society, 1930 , p. 313,318 |
|
~%
ethyl 2,4-dihyd... CAS#:31581-32-5 |
| Literature: Robertson; Stephenson Journal of the Chemical Society, 1930 , p. 313,318 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Betorcinolcarbonsaeure-aethylester |
| ethyl 3-methylorsellinate |
| 2,4-dihydroxy-3,6-dimethyl-benzoic acid ethyl ester |
| orsellinate |
| 2,4-Dihydroxy-3,6-dimethyl-benzoesaeure-aethylester |