2-bromo-6-(3-bromo-5-chloro-2-hydroxyphenyl)sulfanyl-4-chlorophenol structure
|
Common Name | 2-bromo-6-(3-bromo-5-chloro-2-hydroxyphenyl)sulfanyl-4-chlorophenol | ||
|---|---|---|---|---|
| CAS Number | 3161-15-7 | Molecular Weight | 444.95400 | |
| Density | 2.15g/cm3 | Boiling Point | 447.8ºC at 760 mmHg | |
| Molecular Formula | C12H6Br2Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | 2-bromo-6-(3-bromo-5-chloro-2-hydroxyphenyl)sulfanyl-4-chlorophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.15g/cm3 |
|---|---|
| Boiling Point | 447.8ºC at 760 mmHg |
| Molecular Formula | C12H6Br2Cl2O2S |
| Molecular Weight | 444.95400 |
| Flash Point | 224.6ºC |
| Exact Mass | 441.78300 |
| PSA | 65.76000 |
| LogP | 6.08080 |
| Index of Refraction | 1.791 |
| InChIKey | GAKNPUYHWSZTIO-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)cc(Cl)cc1Sc1cc(Cl)cc(Br)c1O |
| HS Code | 2930909090 |
|---|
|
~%
2-bromo-6-(3-br... CAS#:3161-15-7 |
| Literature: Rohm and Haas Co. Patent: US2702302 , 1954 ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6,6'-dibromo-4,4'-dichloro-2,2'-sulfanediyl-di-phenol |
| Bio-0391 |
| Bis-(3-brom-5-chlor-2-hydroxyphenyl)sulfid |
| Galosfen |
| A 9387 |
| 6,6'-Dibrom-4,4'-dichlor-2,2'-sulfandiyl-di-phenol |
| 2,2'-Dihydroxy-3,3'-dibrom-5,5'-dichlor-diphenylsulfid |