1,2-dichloro-4-(3,4-dichlorophenyl)-5-nitrobenzene structure
|
Common Name | 1,2-dichloro-4-(3,4-dichlorophenyl)-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 31610-10-3 | Molecular Weight | 336.98600 | |
| Density | 1.572g/cm3 | Boiling Point | 424.4ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
| Name | 1,2-dichloro-4-(3,4-dichlorophenyl)-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760 mmHg |
| Molecular Formula | C12H5Cl4NO2 |
| Molecular Weight | 336.98600 |
| Flash Point | 210.5ºC |
| Exact Mass | 334.90700 |
| PSA | 45.82000 |
| LogP | 6.39860 |
| Index of Refraction | 1.637 |
| InChIKey | JLPJDJUIKALVDN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1-c1ccc(Cl)c(Cl)c1 |
|
~%
1,2-dichloro-4-... CAS#:31610-10-3 |
| Literature: Hickmott,P.W.; Hudson,A.T. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 762 - 764 |
|
~%
1,2-dichloro-4-... CAS#:31610-10-3 |
| Literature: Hickmott,P.W.; Hudson,A.T. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 762 - 764 |
| 3,3',4,4'-Tetrachlor-6-nitrobiphenyl |
| 2-Nitro-3'-4,4',5-tetrachlorbiphenyl |