4H-1-Benzopyran-4-one, 2- (2,4-dihydroxyphenyl)-5, 7-dihydroxy-6-(3-methyl-2-butenyl)- structure
|
Common Name | 4H-1-Benzopyran-4-one, 2- (2,4-dihydroxyphenyl)-5, 7-dihydroxy-6-(3-methyl-2-butenyl)- | ||
|---|---|---|---|---|
| CAS Number | 3162-09-2 | Molecular Weight | 354.35300 | |
| Density | 1.424g/cm3 | Boiling Point | 635.7ºC at 760 mmHg | |
| Molecular Formula | C20H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 635.7ºC at 760 mmHg |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.35300 |
| Flash Point | 230.9ºC |
| Exact Mass | 354.11000 |
| PSA | 111.13000 |
| LogP | 3.79110 |
| Index of Refraction | 1.69 |
| InChIKey | YWUVFGZTDLJVCR-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)cc2oc(-c3ccc(O)cc3O)cc(=O)c2c1O |
| HS Code | 2914501900 |
|---|
|
~%
4H-1-Benzopyran... CAS#:3162-09-2 |
| Literature: Dong, Xiaowu; Zhou, Xinglu; Jing, Hui; Chen, Jianzhong; Liu, Tao; Yang, Bo; He, Qiaojun; Hu, Yongzhou European Journal of Medicinal Chemistry, 2011 , vol. 46, # 12 p. 5949 - 5958 |
|
~%
4H-1-Benzopyran... CAS#:3162-09-2 |
| Literature: Dong, Xiaowu; Zhou, Xinglu; Jing, Hui; Chen, Jianzhong; Liu, Tao; Yang, Bo; He, Qiaojun; Hu, Yongzhou European Journal of Medicinal Chemistry, 2011 , vol. 46, # 12 p. 5949 - 5958 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2',4',5,7-tetrahydroxy-6-(3,3-dimethylallyl)flavone |
| 2-(2,4-dihydroxy-phenyl)-5,7-dihydroxy-6-(3-methyl-but-2-enyl)-chromen-4-one |
| Artocarpesin |