4H-1-Benzopyran-4-one,2-(1,3-benzodioxol-5-yl)-5,6,7,8-tetramethoxy- structure
|
Common Name | 4H-1-Benzopyran-4-one,2-(1,3-benzodioxol-5-yl)-5,6,7,8-tetramethoxy- | ||
|---|---|---|---|---|
| CAS Number | 3162-42-3 | Molecular Weight | 386.35200 | |
| Density | 1.348g/cm3 | Boiling Point | 590.9ºC at 760 mmHg | |
| Molecular Formula | C20H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260ºC | |
| Name | 2-(1,3-benzodioxol-5-yl)-5,6,7,8-tetramethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 590.9ºC at 760 mmHg |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.35200 |
| Flash Point | 260ºC |
| Exact Mass | 386.10000 |
| PSA | 85.59000 |
| LogP | 3.22310 |
| Index of Refraction | 1.593 |
| InChIKey | LKUJKDQDJLCGCT-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(OC)c2c(=O)cc(-c3ccc4c(c3)OCO4)oc2c1OC |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6,7,8-Tetramethoxy-3',4'-(methylenedioxy)flavone |
| 2-(1,3-Benzodioxol-5-yl)-5,6,7,8-tetramethoxy-4H-chromen-4-one |
| 3',4'-methylenedioxy-5,6,7,8-tetramethoxyflavone |
| 2-benzo[1,3]dioxol-5-yl-5,6,7,8-tetramethoxy-chromen-4-one |
| Lucidin,dimethyl ether |
| Linderoflavone B |