dimethyl 4-oxopiperidine-1,3-dicarboxylate structure
|
Common Name | dimethyl 4-oxopiperidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 31633-70-2 | Molecular Weight | 215.20300 | |
| Density | 1.271g/cm3 | Boiling Point | 321ºC at 760mmHg | |
| Molecular Formula | C9H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.9ºC | |
| Name | dimethyl 4-oxopiperidine-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 321ºC at 760mmHg |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20300 |
| Flash Point | 147.9ºC |
| Exact Mass | 215.07900 |
| PSA | 72.91000 |
| Index of Refraction | 1.486 |
| InChIKey | GBZKFFZVVUNDFQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C(=O)OC)CCC1=O |
| HS Code | 2933399090 |
|---|
|
~97%
dimethyl 4-oxop... CAS#:31633-70-2 |
| Literature: Burke Jr.; Jacobson; Rice; Silverton; Simonds; Streaty; Klee Journal of Medicinal Chemistry, 1986 , vol. 29, # 6 p. 1087 - 1093 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-carbomethoxy-4-oxo-1-piperidinecarboxylate |
| 1,3-dicarbomethoxy-4-oxopiperidine |
| 1,3-Piperidinedicarboxylicacid,4-oxo-,1,3-dimethyl ester |
| EINECS 250-737-9 |
| Dimethyl-4-oxo-1,3-piperidindicarboxylat |
| 4-Oxo-1,3-piperidinedicarboxylic acid 1,3-dimethyl ester |