alpha-(trichloromethyl)benzyl propionate structure
|
Common Name | alpha-(trichloromethyl)benzyl propionate | ||
|---|---|---|---|---|
| CAS Number | 31643-14-8 | Molecular Weight | 281.56300 | |
| Density | 1.339g/cm3 | Boiling Point | 364.4ºC at 760mmHg | |
| Molecular Formula | C11H11Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.5ºC | |
| Name | (2,2,2-trichloro-1-phenylethyl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 364.4ºC at 760mmHg |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.56300 |
| Flash Point | 146.5ºC |
| Exact Mass | 279.98200 |
| PSA | 26.30000 |
| LogP | 4.05110 |
| Index of Refraction | 1.54 |
| InChIKey | UCXKKRMHRMTKQF-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC(c1ccccc1)C(Cl)(Cl)Cl |
| HS Code | 2915509000 |
|---|
|
~%
alpha-(trichlor... CAS#:31643-14-8 |
| Literature: Mitchell Perfumery and Essential Oil Record, 1950 , vol. 41, p. 41 |
|
~%
alpha-(trichlor... CAS#:31643-14-8 |
| Literature: Mitchell Perfumery and Essential Oil Record, 1950 , vol. 41, p. 41 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915509000 |
|---|---|
| Summary | 2915509000 propionic acid, its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| einecs 250-747-3 |