4-Chloro-7-nitro-1H-indazole structure
|
Common Name | 4-Chloro-7-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 316810-81-8 | Molecular Weight | 197.579 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 410.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9±23.2 °C | |
| Name | 4-chloro-7-nitro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 410.1±25.0 °C at 760 mmHg |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Flash Point | 201.9±23.2 °C |
| Exact Mass | 196.999207 |
| PSA | 74.50000 |
| LogP | 2.10 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | MGCGMFQHBXYECU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c2cn[nH]c12 |
|
~65%
4-Chloro-7-nitr... CAS#:316810-81-8 |
| Literature: Rakib; Benchidmi; Essassi; El Bouadili; Ibn Mansour; Bellan; Lopez; Lamande Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2000 , vol. 39, # 5 p. 339 - 345 |
|
~%
4-Chloro-7-nitr... CAS#:316810-81-8 |
| Literature: Rakib; Benchidmi; Essassi; El Bouadili; Ibn Mansour; Bellan; Lopez; Lamande Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2000 , vol. 39, # 5 p. 339 - 345 |
|
~%
4-Chloro-7-nitr... CAS#:316810-81-8 |
| Literature: Morgan; Drew Journal of the Chemical Society, 1920 , vol. 117, p. 789 |
| 4-chloro-7-nitro-1(2)H-indazole |
| 1H-Indazole,4-chloro-7-nitro |
| 1H-Indazole, 4-chloro-7-nitro- |
| 4-Chloro-7-nitro-1H-indazole |
| 4-Chlor-7-nitro-1(2)H-indazol |
| 4-Chloro-7-nitro indazole |