1-(1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-4-yl)-3-prop-2-enylthiourea structure
|
Common Name | 1-(1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-4-yl)-3-prop-2-enylthiourea | ||
|---|---|---|---|---|
| CAS Number | 31683-82-6 | Molecular Weight | 270.37400 | |
| Density | 1.35g/cm3 | Boiling Point | 356.4ºC at 760mmHg | |
| Molecular Formula | C10H14N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.3ºC | |
| Name | 1-(1,3-dimethyl-6-oxo-2-sulfanylidenepyrimidin-4-yl)-3-prop-2-enylthiourea |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 356.4ºC at 760mmHg |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.37400 |
| Flash Point | 169.3ºC |
| Exact Mass | 270.06100 |
| PSA | 122.21000 |
| LogP | 1.41000 |
| Index of Refraction | 1.675 |
| InChIKey | BEXRJLODQPFVSK-UHFFFAOYSA-N |
| SMILES | C=CCNC(=S)Nc1cc(=O)n(C)c(=S)n1C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |