1,3-Butanedione,1-(2,5-dimethyl-3-furanyl)-4,4,4-trifluoro-2-methyl- structure
|
Common Name | 1,3-Butanedione,1-(2,5-dimethyl-3-furanyl)-4,4,4-trifluoro-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 317-43-1 | Molecular Weight | 248.19800 | |
| Density | 1.242g/cm3 | Boiling Point | 265.9ºC at 760mmHg | |
| Molecular Formula | C11H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6ºC | |
| Name | 1-(2,5-dimethylfuran-3-yl)-4,4,4-trifluoro-2-methylbutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 265.9ºC at 760mmHg |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.19800 |
| Flash Point | 114.6ºC |
| Exact Mass | 248.06600 |
| PSA | 47.28000 |
| LogP | 2.84660 |
| Index of Refraction | 1.439 |
| InChIKey | UDYGIQMXOWZSIV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)C(C)C(=O)C(F)(F)F)c(C)o1 |
|
~%
1,3-Butanedione... CAS#:317-43-1 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1953 , vol. 75, p. 2059,2061 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(2,5-Dimethyl-[3]furyl)-4,4,4-trifluor-2-methyl-butan-1,3-dion |
| 1-(2,5-dimethyl-[3]furyl)-4,4,4-trifluoro-2-methyl-butane-1,3-dione |