1,3-Butanedione,1-(2,5-dimethyl-3-thienyl)-4,4,4-trifluoro-2-methyl
Modify Date: 2025-11-25 20:22:57
1,3-Butanedione,1-(2,5-dimethyl-3-thienyl)-4,4,4-trifluoro-2-methyl structure
|
Common Name | 1,3-Butanedione,1-(2,5-dimethyl-3-thienyl)-4,4,4-trifluoro-2-methyl | ||
|---|---|---|---|---|
| CAS Number | 317-44-2 | Molecular Weight | 264.26400 | |
| Density | 1.28g/cm3 | Boiling Point | 297.2ºC at 760mmHg | |
| Molecular Formula | C11H11F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.6ºC | |
| Name | 1-(2,5-dimethylthiophen-3-yl)-4,4,4-trifluoro-2-methylbutane-1,3-dione |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 297.2ºC at 760mmHg |
| Molecular Formula | C11H11F3O2S |
| Molecular Weight | 264.26400 |
| Flash Point | 133.6ºC |
| Exact Mass | 264.04300 |
| PSA | 62.38000 |
| LogP | 3.31510 |
| Index of Refraction | 1.48 |
| InChIKey | MUANZXAIUMTQTP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)C(C)C(=O)C(F)(F)F)c(C)s1 |
|
~%
1,3-Butanedione... CAS#:317-44-2 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1953 , vol. 75, p. 2059,2061 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1