4-(Trifluoromethyl)-1H-indole-2-carboxylic acid structure
|
Common Name | 4-(Trifluoromethyl)-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 317-59-9 | Molecular Weight | 229.155 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 402.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2±27.3 °C | |
| Name | 4-(Trifluoromethyl)-1H-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.5±40.0 °C at 760 mmHg |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.155 |
| Flash Point | 197.2±27.3 °C |
| Exact Mass | 229.035065 |
| PSA | 53.09000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | MOVKDRSEEJWXRI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2c(C(F)(F)F)cccc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
4-(Trifluoromet... CAS#:317-59-9 |
| Literature: Bornstein et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 1745,1747 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-2-carboxylic acid, 4-(trifluoromethyl)- |
| 4-Trifluormethyl-indol-2-carbonsaeure |
| 4-trifluoromethyl-indole-2-carboxylic acid |
| 4-Trifluormethyl-chinaldonitril |
| 4-(Trifluoromethyl)-1H-indole-2-carboxylic acid |
| 4-trifluoromethyl-quinoline-2-carbonitrile |