Ethyl 2-bromo-3-nitrobenzoate structure
|
Common Name | Ethyl 2-bromo-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 31706-23-7 | Molecular Weight | 274.068 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 314.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.0±22.3 °C | |
| Name | Ethyl 2-bromo-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.5±22.0 °C at 760 mmHg |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.068 |
| Flash Point | 144.0±22.3 °C |
| Exact Mass | 272.963654 |
| PSA | 72.12000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | WTNZOABLVURCTP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc([N+](=O)[O-])c1Br |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 2-bromo-3-nitro-, ethyl ester |
| Ethyl 2-bromo-3-nitrobenzoate |
| 2-Brom-3-nitrobenzoesaeureaethylester |