4-Pyridinecarboxylicacid, 3-cyano-6-ethyl-1,2-dihydro-2-oxo-, ethyl ester
Modify Date: 2025-09-05 14:26:29
4-Pyridinecarboxylicacid, 3-cyano-6-ethyl-1,2-dihydro-2-oxo-, ethyl ester structure
|
Common Name | 4-Pyridinecarboxylicacid, 3-cyano-6-ethyl-1,2-dihydro-2-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 31718-05-5 | Molecular Weight | 220.22500 | |
| Density | 1.22g/cm3 | Boiling Point | 382.3ºC at 760mmHg | |
| Molecular Formula | C11H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | ethyl 3-cyano-6-ethyl-2-oxo-1H-pyridine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 382.3ºC at 760mmHg |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.22500 |
| Flash Point | 185ºC |
| Exact Mass | 220.08500 |
| PSA | 82.95000 |
| LogP | 0.98568 |
| Index of Refraction | 1.53 |
| InChIKey | NLZXUSXZGVQQLQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(CC)[nH]c(=O)c1C#N |
| HS Code | 2933399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:3376-96-3
CAS#:54881-17-3| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-cyano-6-ethyl-2-oxo-1,2-dihydropyridine-4-carboxylate |
| 3-cyano-6-ethyl-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid,ethyl ester |
| 2-Ethyl-4-ethoxycarbonyl-5-cyano-6-pyridon |