4-diethoxyphosphinothioylsulfanylbenzenesulfonamide
Modify Date: 2025-09-19 15:49:46
4-diethoxyphosphinothioylsulfanylbenzenesulfonamide structure
|
Common Name | 4-diethoxyphosphinothioylsulfanylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 3172-04-1 | Molecular Weight | 341.40700 | |
| Density | 1.42g/cm3 | Boiling Point | 469.2ºC at 760 mmHg | |
| Molecular Formula | C10H16NO4PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.6ºC | |
| Name | 4-diethoxyphosphinothioylsulfanylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 469.2ºC at 760 mmHg |
| Molecular Formula | C10H16NO4PS3 |
| Molecular Weight | 341.40700 |
| Flash Point | 237.6ºC |
| Exact Mass | 340.99800 |
| PSA | 154.20000 |
| LogP | 5.15530 |
| Index of Refraction | 1.609 |
| InChIKey | SYNGDJNSQZDNLX-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Sc1ccc(S(N)(=O)=O)cc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzenesulfonamide,p-mercapto-,S-ester with O,O-diethylphosphorodithioate |
| Phosphorodithioic acid,O,O-diethyl ester,S-ester with p-mercaptobenzenesulfonamide |