1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile
Modify Date: 2026-08-03 17:08:17
![1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile Structure](https://www.chemsrc.com/extcaspic/013/31731-30-3.png)
1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile structure
|
Common Name | 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 31731-30-3 | Molecular Weight | 226.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14N2O |
|---|---|
| Molecular Weight | 226.27 |
| InChIKey | SBZYHKYGEXMCJX-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CCCc3c(C#N)ccc1c32 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile? |
| A: InChIKey of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile is SBZYHKYGEXMCJX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile? |
| A: Molecular formula of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile is C14H14N2O. |
| Q: What is the CAS number of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile? |
| A: CAS number of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile is 31731-30-3. |
| Q: What is the SMILES notation of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile? |
| A: SMILES notation of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile is CC(=O)N1CC2CCCc3c(C#N)ccc1c32. |
| Q: What is the molecular weight of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile? |
| A: Molecular weight of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile is 226.27. |
| Q: What is the English name of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile? |
| A: The English name of 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile is 1-Acetyl-1,2,2a,3,4,5-hexahydrobenz[cd]indole-6-carbonitrile. |
| Q: What is the Chinese name of 31731-30-3? |
| A: Chinese name of 31731-30-3 is 31731-30-3. |