2-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide structure
|
Common Name | 2-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 3174-15-0 | Molecular Weight | 240.70900 | |
| Density | 1.441g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.441g/cm3 |
|---|---|
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.70900 |
| Exact Mass | 240.01200 |
| PSA | 70.23000 |
| LogP | 2.85500 |
| Index of Refraction | 1.699 |
| InChIKey | UKCZXXXZRMGCMJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(NC(=O)CCl)sc2c1 |
| HS Code | 2934200090 |
|---|
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloracetylamino-6-methyl-benzothiazol |
| chloroacetyl-6-methylaminobenzothiazole |