1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane
1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane structure
|
Common Name | 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane | ||
|---|---|---|---|---|
| CAS Number | 3175-64-2 | Molecular Weight | 253.83800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3Cl4F4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C3Cl4F4 |
|---|---|
| Molecular Weight | 253.83800 |
| Exact Mass | 251.86900 |
| LogP | 3.82350 |
| InChIKey | BFJGKEZYSSAZTR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(Cl)C(Cl)(Cl)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:2804-55-9
CAS#:1599-41-3
CAS#:76-17-5
CAS#:812-30-6
CAS#:1652-80-8
CAS#:661-97-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,1,2-Tetrafluortetrachlorpropan |
| CFC-214bb |
| 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoro-propane |
| 1,1,1,2-Tetrachlor-2,3,3,3-tetrafluor-propan |
| 1,1,1,2-tetrachlorotetrafluoropropane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: Molecular weight of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is 253.83800. |
| Q: What is the Chinese name of 3175-64-2? |
| A: Chinese name of 3175-64-2 is 3175-64-2. |
| Q: What is the LogP of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: LogP of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is 3.82350. |
| Q: What are the downstream products of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: Related downstream products(CAS) of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane: 2804-55-9;1599-41-3;76-17-5;812-30-6;1652-80-8;661-97-2. |
| Q: What English synonyms does 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane have? |
| A: English synonyms of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane: 1,1,1,2-Tetrafluortetrachlorpropan, CFC-214bb, 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoro-propane, 1,1,1,2-Tetrachlor-2,3,3,3-tetrafluor-propan, 1,1,1,2-tetrachlorotetrafluoropropane. |
| Q: What is the English name of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: The English name of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane. |
| Q: What is the SMILES notation of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: SMILES notation of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is FC(F)(F)C(F)(Cl)C(Cl)(Cl)Cl. |
| Q: What is the InChIKey of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: InChIKey of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is BFJGKEZYSSAZTR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: CAS number of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is 3175-64-2. |
| Q: What is the molecular formula of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane? |
| A: Molecular formula of 1,1,1,2-tetrachloro-2,3,3,3-tetrafluoropropane is C3Cl4F4. |