N-(2-Chloro-6-methylphenyl)carbamic acid 1-tert-butyl-3-pyrrolidinyl ester structure
|
Common Name | N-(2-Chloro-6-methylphenyl)carbamic acid 1-tert-butyl-3-pyrrolidinyl ester | ||
|---|---|---|---|---|
| CAS Number | 31755-08-5 | Molecular Weight | 310.81900 | |
| Density | 1.17g/cm3 | Boiling Point | 361.5ºC at 760mmHg | |
| Molecular Formula | C16H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | (1-tert-butylpyrrolidin-3-yl) N-(2-chloro-6-methylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 361.5ºC at 760mmHg |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.81900 |
| Flash Point | 172.4ºC |
| Exact Mass | 310.14500 |
| PSA | 45.06000 |
| LogP | 4.02120 |
| Index of Refraction | 1.558 |
| InChIKey | HZPVYVIKZIPUDA-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Cl)c1NC(=O)OC1CCN(C(C)(C)C)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-6-methylcarbanilic acid,N-tert-butyl-3-pyrrolidinyl ester |
| N-tert-Butyl-3-pyrrolidinyl 2-chloro-6-methylcarbanilate |
| CARBANILIC ACID,2-CHLORO-6-METHYL-,N-tert-BUTYL-3-PYRROLIDINYL ESTER |
| N-tert-Butyl-3-pyrrolidyl 2-chloro-6-methylphenylcarbamate |