N-(2,6-Dimethylphenyl)carbamic acid 1-propyl-3-pyrrolidinyl ester structure
|
Common Name | N-(2,6-Dimethylphenyl)carbamic acid 1-propyl-3-pyrrolidinyl ester | ||
|---|---|---|---|---|
| CAS Number | 31755-11-0 | Molecular Weight | 276.37400 | |
| Density | 1.09g/cm3 | Boiling Point | 344.7ºC at 760mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | (1-propylpyrrolidin-3-yl) N-(2,6-dimethylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 344.7ºC at 760mmHg |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37400 |
| Flash Point | 162.3ºC |
| Exact Mass | 276.18400 |
| PSA | 45.06000 |
| LogP | 3.28770 |
| Index of Refraction | 1.549 |
| InChIKey | BNQKBUOGDLGSFJ-UHFFFAOYSA-N |
| SMILES | CCCN1CCC(OC(=O)Nc2c(C)cccc2C)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CARBANILIC ACID,2,6-DIMETHYL-,N-PROPYL-3-PYRROLIDINYL ESTER |
| N-Propyl-3-pyrrolidinyl 2,6-dimethylcarbanilate |
| N-Propyl-3-pyrrolidyl 2,6-dimethylphenylcarbamate |
| 2,6-Dimethylcarbanilic acid,N-propyl-3-pyrrolidinyl ester |