N-(2,6-Dimethylphenyl)carbamic acid 1-methyl-3-piperidinyl ester
Modify Date: 2025-09-24 20:11:29
N-(2,6-Dimethylphenyl)carbamic acid 1-methyl-3-piperidinyl ester structure
|
Common Name | N-(2,6-Dimethylphenyl)carbamic acid 1-methyl-3-piperidinyl ester | ||
|---|---|---|---|---|
| CAS Number | 31755-14-3 | Molecular Weight | 262.34700 | |
| Density | 1.11g/cm3 | Boiling Point | 330.3ºC at 760mmHg | |
| Molecular Formula | C15H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.5ºC | |
| Name | (1-methylpiperidin-3-yl) N-(2,6-dimethylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 330.3ºC at 760mmHg |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.34700 |
| Flash Point | 153.5ºC |
| Exact Mass | 262.16800 |
| PSA | 45.06000 |
| LogP | 2.89760 |
| Index of Refraction | 1.554 |
| InChIKey | YYEAOJQVTHGSAL-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1NC(=O)OC1CCCN(C)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Methyl-3-piperidyl 2,6-dimethylphenylcarbamate |
| CARBANILIC ACID,2,6-DIMETHYL-,N-METHYL-3-PIPERIDINYL ESTER |
| N-Methyl-3-piperidinyl 2,6-dimethylcarbanilate |
| 2,6-Dimethylcarbanilic acid,N-methyl-3-piperidinyl ester |