2H-1,3-Oxazine,tetrahydro-4,4,6-trimethyl-2-phenyl structure
|
Common Name | 2H-1,3-Oxazine,tetrahydro-4,4,6-trimethyl-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 31771-33-2 | Molecular Weight | 205.29600 | |
| Density | 0.949g/cm3 | Boiling Point | 292.7ºC at 760mmHg | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.2ºC | |
| Name | 4,4,6-trimethyl-2-phenyl-1,3-oxazinane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.949g/cm3 |
|---|---|
| Boiling Point | 292.7ºC at 760mmHg |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.29600 |
| Flash Point | 121.2ºC |
| Exact Mass | 205.14700 |
| PSA | 21.26000 |
| LogP | 3.19100 |
| Index of Refraction | 1.484 |
| InChIKey | LIYXZGJOUFBNHP-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)NC(c2ccccc2)O1 |
| HS Code | 2934999090 |
|---|
|
~%
2H-1,3-Oxazine,... CAS#:31771-33-2 |
| Literature: Bayer and Co. Patent: DE291222 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 802 |
|
~%
2H-1,3-Oxazine,... CAS#:31771-33-2 |
| Literature: Urbanski; Gac-Chylinska Roczniki Chemii, 1956 , vol. 30, p. 185,191 Chem.Abstr., 1957 , p. 1186 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4,6-Trimethyl-2-phenyl-tetrahydro-[1,3]oxazin |
| 2-phenyl-4,4,6-trimethyltetrahydro-(2H)-1,3-oxazine |
| 4,4,6-trimethyl-2-phenyl-tetrahydro-[1,3]oxazine |
| 4,4,6-trimethyl-2-phenyl-[1,3]oxazinane |