phenyl-[2-(piperidine-1-carbonyl)phenyl]methanone structure
|
Common Name | phenyl-[2-(piperidine-1-carbonyl)phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 31802-12-7 | Molecular Weight | 293.36000 | |
| Density | 1.161g/cm3 | Boiling Point | 502.4ºC at 760mmHg | |
| Molecular Formula | C19H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.1ºC | |
| Name | phenyl-[2-(piperidine-1-carbonyl)phenyl]methanone |
|---|
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 502.4ºC at 760mmHg |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.36000 |
| Flash Point | 231.1ºC |
| Exact Mass | 293.14200 |
| PSA | 37.38000 |
| LogP | 3.48160 |
| Index of Refraction | 1.596 |
| InChIKey | FDSFGVBXPQHBHH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccccc1C(=O)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |