2-[3-[4-(o-Chlorophenyl)-1-piperazinyl]propyl]-2-phenyl-1,3-indanedione
Modify Date: 2025-11-30 11:18:55
![2-[3-[4-(o-Chlorophenyl)-1-piperazinyl]propyl]-2-phenyl-1,3-indanedione Structure](https://image.chemsrc.com/caspic/470/31804-91-8.png)
2-[3-[4-(o-Chlorophenyl)-1-piperazinyl]propyl]-2-phenyl-1,3-indanedione structure
|
Common Name | 2-[3-[4-(o-Chlorophenyl)-1-piperazinyl]propyl]-2-phenyl-1,3-indanedione | ||
|---|---|---|---|---|
| CAS Number | 31804-91-8 | Molecular Weight | 458.97900 | |
| Density | 1.244g/cm3 | Boiling Point | 626.1ºC at 760mmHg | |
| Molecular Formula | C28H27ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.4ºC | |
| Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-2-phenylindene-1,3-dione |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 626.1ºC at 760mmHg |
| Molecular Formula | C28H27ClN2O2 |
| Molecular Weight | 458.97900 |
| Flash Point | 332.4ºC |
| Exact Mass | 458.17600 |
| PSA | 40.62000 |
| LogP | 5.26230 |
| Index of Refraction | 1.621 |
| InChIKey | WKNKPKZNKUHIQC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1(CCCN1CCN(c2ccccc2Cl)CC1)c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |