N,N'-dihexyldecanediamide structure
|
Common Name | N,N'-dihexyldecanediamide | ||
|---|---|---|---|---|
| CAS Number | 31827-03-9 | Molecular Weight | 368.59700 | |
| Density | 0.913g/cm3 | Boiling Point | 564ºC at 760 mmHg | |
| Molecular Formula | C22H44N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.2ºC | |
| Name | N,N'-dihexyldecanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.913g/cm3 |
|---|---|
| Boiling Point | 564ºC at 760 mmHg |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.59700 |
| Flash Point | 153.2ºC |
| Exact Mass | 368.34000 |
| PSA | 65.18000 |
| LogP | 7.18080 |
| Index of Refraction | 1.463 |
| InChIKey | ANLFZJDBTDDXJA-UHFFFAOYSA-N |
| SMILES | CCCCCCNC(=O)CCCCCCCCC(=O)NCCCCCC |
| HS Code | 2924199090 |
|---|
|
~94%
N,N'-dihexyldec... CAS#:31827-03-9 |
| Literature: Malineni, Jagadeesh; Merkens, Carina; Keul, Helmut; Moeller, Martin Catalysis Communications, 2013 , vol. 40, p. 80 - 83 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Di-n-hexylsebacamide |
| Decandisaeure-bis-hexylamid |
| N,N'-dihexyl-decanediamide |
| N,N'-Dihexyl-sebacinamid |
| N,N'-Dihexyl-decandiamid |