Benzamide,N-[2-[bis(2-chloroethyl)amino]-2-oxoethyl]- structure
|
Common Name | Benzamide,N-[2-[bis(2-chloroethyl)amino]-2-oxoethyl]- | ||
|---|---|---|---|---|
| CAS Number | 3183-26-4 | Molecular Weight | 303.18400 | |
| Density | 1.266g/cm3 | Boiling Point | 519.3ºC at 760 mmHg | |
| Molecular Formula | C13H16Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.8ºC | |
| Name | N-[2-[bis(2-chloroethyl)amino]-2-oxoethyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 519.3ºC at 760 mmHg |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.18400 |
| Flash Point | 267.8ºC |
| Exact Mass | 302.05900 |
| PSA | 49.41000 |
| LogP | 2.11350 |
| Index of Refraction | 1.551 |
| InChIKey | BJPBSMWEONIDJW-UHFFFAOYSA-N |
| SMILES | O=C(NCC(=O)N(CCCl)CCCl)c1ccccc1 |
|
~%
Benzamide,N-[2-... CAS#:3183-26-4 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-Bis-(2-chlor-ethyl)-2-benzamino-acetamid |