Butanamide,2-(acetylamino)-N,N-bis(2-chloroethyl)-4-(methylthio)- structure
|
Common Name | Butanamide,2-(acetylamino)-N,N-bis(2-chloroethyl)-4-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 3183-33-3 | Molecular Weight | 315.26000 | |
| Density | 1.224g/cm3 | Boiling Point | 521.3ºC at 760mmHg | |
| Molecular Formula | C11H20Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269ºC | |
| Name | 2-acetamido-N,N-bis(2-chloroethyl)-4-methylsulfanylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 521.3ºC at 760mmHg |
| Molecular Formula | C11H20Cl2N2O2S |
| Molecular Weight | 315.26000 |
| Flash Point | 269ºC |
| Exact Mass | 314.06200 |
| PSA | 74.71000 |
| LogP | 1.94130 |
| Index of Refraction | 1.518 |
| InChIKey | ARQGMTIGMDIVTK-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(C)=O)C(=O)N(CCCl)CCCl |
|
~%
Butanamide,2-(a... CAS#:3183-33-3 |
| Literature: Levi,I. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 715 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Acetamino-4-methylmercapto-buttersaeure-[bis-(2-chlor-ethyl)-amid] |