3,4-Dihydro-3-oxo-2-propyl-2H-1,2-benzothiazine 1,1-dioxide structure
|
Common Name | 3,4-Dihydro-3-oxo-2-propyl-2H-1,2-benzothiazine 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 31848-15-4 | Molecular Weight | 239.29100 | |
| Density | 1.297g/cm3 | Boiling Point | 391.8ºC at 760mmHg | |
| Molecular Formula | C11H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.7ºC | |
| Name | 1,1-dioxo-2-propyl-4H-1λ6,2-benzothiazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 391.8ºC at 760mmHg |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.29100 |
| Flash Point | 190.7ºC |
| Exact Mass | 239.06200 |
| PSA | 62.83000 |
| LogP | 2.18870 |
| Index of Refraction | 1.571 |
| InChIKey | TYIYSVLVQMZJDR-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)Cc2ccccc2S1(=O)=O |
| HS Code | 2914399090 |
|---|
|
~%
3,4-Dihydro-3-o... CAS#:31848-15-4 |
| Literature: Sianesi; Redaelli; Magistretti; Massarani Journal of Medicinal Chemistry, 1973 , vol. 16, # 10 p. 1133 - 1137 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-Propyl-3,4-dihydro-3-oxo-2H-1,2-benzothiazin-S-dioxid |
| 1,1-dioxo-2-propyl-4H-1 |